
CAS:163105-90-6 | 2-Methoxypyridine-3-boronic Acid
Molecular Formula:C6H8BNO3
Molecular Weight:152.95 g/mol
Purity:97%
Package:100g/250g/500g/1kg/bulk package
Transportation: FeDex/DHL/Ocean shipping /Clients requirement
- تحویل در سراسر جهان
- تضمین کیفیت
- خدمات مشتریان 24/7
معرفی محصول
Applications
2-Methoxypyridine-3-boronic acid has been used in various scientific research applications, such as catalysis and organic synthesis. It is used as a catalyst in the Suzuki-Miyaura reaction, which is a widely used cross-coupling reaction for the synthesis of biaryl compounds. 2-Methoxypyridine-3-boronic acid has also been used in the synthesis of various heterocyclic compounds, such as pyridines, imidazoles, and pyrazoles. In addition, 2-Methoxypyridine-3-boronic acid has been used in the synthesis of various pharmaceutical compounds, such as antifungal agents, anti-inflammatory agents, and antiviral agents.
Specification
|
ITEMS |
SPECIFICATION |
| IUPAC Name | (2-methoxypyridin-3-yl)boronic acid |
| MDL No | MFCD03411572 |
| Density | 1.24g/cm3 |
| BP | 326.4ºC at 760 mmHg |
| MP | 136-138ºC |
| FP | 151.2ºC |
| Index of Refraction | 1.523 |
| Vapour Pressure | 8.78E-05mmHg at 25°C |
| Storage condition | Inert atmosphere,2-8°C |
| InChI | InChI=1S/C6H8BNO3/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4,9-10H,1H3 |
| InChI Key | NVOLYUXUHWBCRJ-UHFFFAOYSA-N |

تگ های محبوب: cas:163105-90-6 | 2-methoxypyridine-3-boronic acid, price, quotation, discount, in stock, for sale
شما نیز ممکن است دوست داشته باشید
-

CAS:123334-18-9|هیدرات هیدروکلراید تترافنیل لارسونیو...
-
![CAS:1883460-37-4|2،2'-(4،8-بیس(5-(2-اتیل هگزیل)تیوفن-2-یل)بنزو[1،2-b:4،{ {12}}b']دی تیوفن-2،6-دییل) بیس (4،4،5،{18}}تترا متیل-1،3،2-دیوکسابورولان)](/uploads/202235855/small/cas-1883460-37-4-2-2-4-8-bis-5-2-ethylhexyl3c8a532c-fd87-4251-9a34-92b00cea45ad.jpg?size=384x0)
CAS:1883460-37-4|2،2'-(4،8-بیس(5-(2-اتیل هگزیل)تیوفن...
-
![CAS:250726-93-3|2-(2،3-دی هیدروتینو[3،4-b][1،4]دیوکسین-5-یل)-4،4،5،{12 }}تترا متیل-1، 3،2-دیوکسابورولان](/uploads/202235855/small/cas-250726-93-3-2-2-3-dihydrothieno-3-4-b-1a297511a2-2258-4ea7-8a97-c14384487b31.jpg?size=384x0)
CAS:250726-93-3|2-(2،3-دی هیدروتینو[3،4-b][1،4]دیوکس...
-

CAS:19372-44-2|کلسیم استیل استونات
-

CAS:847818-70-6|1-اتیل-4-(4،4،5،5-تترا متیل-1،3،2-دی...
-

CAS:872041-85-5|(5-کلروپیریدین-3-ایل) بورونیک اسید
